N-(1-benzylpiperidin-4-yl)-N-(3,4-dimethoxyphenyl)benzenesulfonamide
Chemical Structure Depiction of
N-(1-benzylpiperidin-4-yl)-N-(3,4-dimethoxyphenyl)benzenesulfonamide
N-(1-benzylpiperidin-4-yl)-N-(3,4-dimethoxyphenyl)benzenesulfonamide
Compound characteristics
| Compound ID: | V012-1403 |
| Compound Name: | N-(1-benzylpiperidin-4-yl)-N-(3,4-dimethoxyphenyl)benzenesulfonamide |
| Molecular Weight: | 466.6 |
| Molecular Formula: | C26 H30 N2 O4 S |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1OC)N(C1CCN(CC1)Cc1ccccc1)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5968 |
| logD: | 4.1953 |
| logSw: | -4.3987 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 50.985 |
| InChI Key: | PLMYAYQQWXAHKI-UHFFFAOYSA-N |