N-(3,4-dimethylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide
N-(3,4-dimethylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | V012-1881 |
| Compound Name: | N-(3,4-dimethylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| Molecular Weight: | 308.38 |
| Molecular Formula: | C19 H20 N2 O2 |
| Smiles: | Cc1ccc(cc1C)NC(C1CC(N(C1)c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1243 |
| logD: | 3.1243 |
| logSw: | -3.1741 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.079 |
| InChI Key: | NGRJISQBFRBTQA-OAHLLOKOSA-N |