N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3-methyl-N-[(oxolan-2-yl)methyl]benzamide
Chemical Structure Depiction of
N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3-methyl-N-[(oxolan-2-yl)methyl]benzamide
N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3-methyl-N-[(oxolan-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | V012-2659 |
| Compound Name: | N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3-methyl-N-[(oxolan-2-yl)methyl]benzamide |
| Molecular Weight: | 447.58 |
| Molecular Formula: | C27 H33 N3 O3 |
| Salt: | not_available |
| Smiles: | CCN(CC)c1c(CN(CC2CCCO2)C(c2cccc(C)c2)=O)c(c2ccccc2)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2447 |
| logD: | 4.2447 |
| logSw: | -4.3031 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 50.414 |
| InChI Key: | YLJOWBSEOGQHAD-HSZRJFAPSA-N |