3-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl]-4-methoxy-N-(4-methoxyphenyl)-N-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
3-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl]-4-methoxy-N-(4-methoxyphenyl)-N-methylbenzene-1-sulfonamide
3-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl]-4-methoxy-N-(4-methoxyphenyl)-N-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-2870 |
| Compound Name: | 3-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl]-4-methoxy-N-(4-methoxyphenyl)-N-methylbenzene-1-sulfonamide |
| Molecular Weight: | 559.7 |
| Molecular Formula: | C27 H33 N3 O6 S2 |
| Salt: | not_available |
| Smiles: | CCc1ccc(cc1)S(N1CCN(CC1)c1cc(ccc1OC)S(N(C)c1ccc(cc1)OC)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3715 |
| logD: | 5.3715 |
| logSw: | -5.4412 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 82.904 |
| InChI Key: | ZWZNDECPJNULQC-UHFFFAOYSA-N |