N-[2-(3,4-dimethoxyphenyl)ethyl]-N~2~-[(3,4-dimethylphenyl)carbamoyl]-N~2~-(2-methoxyethyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-N~2~-[(3,4-dimethylphenyl)carbamoyl]-N~2~-(2-methoxyethyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-N~2~-[(3,4-dimethylphenyl)carbamoyl]-N~2~-(2-methoxyethyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide
Compound characteristics
| Compound ID: | V012-2912 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-N~2~-[(3,4-dimethylphenyl)carbamoyl]-N~2~-(2-methoxyethyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide |
| Molecular Weight: | 553.72 |
| Molecular Formula: | C30 H39 N3 O5 S |
| Smiles: | Cc1ccc(cc1C)NC(N(CCOC)CC(N(CCc1ccc(c(c1)OC)OC)Cc1c(C)ccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.901 |
| logD: | 4.901 |
| logSw: | -4.5945 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.532 |
| InChI Key: | SOBIUNJFFCNUAP-UHFFFAOYSA-N |