N-[4-(dimethylamino)-3-{[(4-fluorobenzene-1-sulfonyl)(propyl)amino]methyl}phenyl]-2-(4-fluorophenyl)acetamide
Chemical Structure Depiction of
N-[4-(dimethylamino)-3-{[(4-fluorobenzene-1-sulfonyl)(propyl)amino]methyl}phenyl]-2-(4-fluorophenyl)acetamide
N-[4-(dimethylamino)-3-{[(4-fluorobenzene-1-sulfonyl)(propyl)amino]methyl}phenyl]-2-(4-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | V012-3045 |
| Compound Name: | N-[4-(dimethylamino)-3-{[(4-fluorobenzene-1-sulfonyl)(propyl)amino]methyl}phenyl]-2-(4-fluorophenyl)acetamide |
| Molecular Weight: | 501.6 |
| Molecular Formula: | C26 H29 F2 N3 O3 S |
| Salt: | not_available |
| Smiles: | CCCN(Cc1cc(ccc1N(C)C)NC(Cc1ccc(cc1)F)=O)S(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0819 |
| logD: | 5.0803 |
| logSw: | -4.996 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.974 |
| InChI Key: | PRQTYGUFPCSNFN-UHFFFAOYSA-N |