2-(3,4-dichlorobenzamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-(3,4-dichlorobenzamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-thiazole-4-carboxamide
2-(3,4-dichlorobenzamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V012-4192 |
| Compound Name: | 2-(3,4-dichlorobenzamido)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 494.4 |
| Molecular Formula: | C22 H21 Cl2 N3 O4 S |
| Salt: | not_available |
| Smiles: | CN(CCc1ccc(c(c1)OC)OC)C(c1csc(NC(c2ccc(c(c2)[Cl])[Cl])=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5959 |
| logD: | 3.6038 |
| logSw: | -4.8002 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.766 |
| InChI Key: | HVKUJBIUDBUADR-UHFFFAOYSA-N |