2-chloro-N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
2-chloro-N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]benzene-1-sulfonamide
2-chloro-N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-4474 |
| Compound Name: | 2-chloro-N-(3,4-dimethoxyphenyl)-N-[(4-methoxyphenyl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 447.94 |
| Molecular Formula: | C22 H22 Cl N O5 S |
| Smiles: | COc1ccc(CN(c2ccc(c(c2)OC)OC)S(c2ccccc2[Cl])(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2909 |
| logD: | 4.2909 |
| logSw: | -4.4708 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.597 |
| InChI Key: | VEVRTUHOCZQQMD-UHFFFAOYSA-N |