4-[5-({[(2-methoxyphenyl)methyl](2-methylpropyl)amino}methyl)furan-2-yl]hepta-1,6-dien-4-ol
Chemical Structure Depiction of
4-[5-({[(2-methoxyphenyl)methyl](2-methylpropyl)amino}methyl)furan-2-yl]hepta-1,6-dien-4-ol
4-[5-({[(2-methoxyphenyl)methyl](2-methylpropyl)amino}methyl)furan-2-yl]hepta-1,6-dien-4-ol
Compound characteristics
| Compound ID: | V012-5141 |
| Compound Name: | 4-[5-({[(2-methoxyphenyl)methyl](2-methylpropyl)amino}methyl)furan-2-yl]hepta-1,6-dien-4-ol |
| Molecular Weight: | 383.53 |
| Molecular Formula: | C24 H33 N O3 |
| Salt: | not_available |
| Smiles: | CC(C)CN(Cc1ccccc1OC)Cc1ccc(C(CC=C)(CC=C)O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.532 |
| logD: | 2.7715 |
| logSw: | -5.5811 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.425 |
| InChI Key: | XVGLBSHPWXLOLW-UHFFFAOYSA-N |