N-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-2-fluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-2-fluorobenzene-1-sulfonamide
N-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-2-fluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-5323 |
| Compound Name: | N-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-2-fluorobenzene-1-sulfonamide |
| Molecular Weight: | 410.29 |
| Molecular Formula: | C19 H14 Cl2 F N O2 S |
| Smiles: | C(c1ccccc1[Cl])N(c1ccc(cc1)[Cl])S(c1ccccc1F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.601 |
| logD: | 5.601 |
| logSw: | -6.0449 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.792 |
| InChI Key: | NVGHYWVHCYLIIV-UHFFFAOYSA-N |