4-chloro-N-(4-fluorophenyl)-N-[1-(2-methylpropyl)piperidin-4-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-(4-fluorophenyl)-N-[1-(2-methylpropyl)piperidin-4-yl]benzene-1-sulfonamide
4-chloro-N-(4-fluorophenyl)-N-[1-(2-methylpropyl)piperidin-4-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-7230 |
| Compound Name: | 4-chloro-N-(4-fluorophenyl)-N-[1-(2-methylpropyl)piperidin-4-yl]benzene-1-sulfonamide |
| Molecular Weight: | 424.96 |
| Molecular Formula: | C21 H26 Cl F N2 O2 S |
| Salt: | not_available |
| Smiles: | CC(C)CN1CCC(CC1)N(c1ccc(cc1)F)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5565 |
| logD: | 4.1773 |
| logSw: | -6.0103 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.995 |
| InChI Key: | PJRKVLJXWPXNAU-UHFFFAOYSA-N |