N-{2-[5-(3,4-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-[4-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-{2-[5-(3,4-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-[4-(trifluoromethyl)phenyl]urea
N-{2-[5-(3,4-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-[4-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | V012-7342 |
| Compound Name: | N-{2-[5-(3,4-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)-N'-[4-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 590.62 |
| Molecular Formula: | C28 H29 F3 N4 O5 S |
| Smiles: | COCCN(CC(N1C(CC(c2cccs2)=N1)c1ccc(c(c1)OC)OC)=O)C(Nc1ccc(cc1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8805 |
| logD: | 4.8805 |
| logSw: | -4.7018 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.491 |
| InChI Key: | SCAHUMJQYZOHNU-JOCHJYFZSA-N |