1-[5-(2-chlorophenyl)-3-(3-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(diethylamino)ethan-1-one
Chemical Structure Depiction of
1-[5-(2-chlorophenyl)-3-(3-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(diethylamino)ethan-1-one
1-[5-(2-chlorophenyl)-3-(3-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(diethylamino)ethan-1-one
Compound characteristics
| Compound ID: | V012-7918 |
| Compound Name: | 1-[5-(2-chlorophenyl)-3-(3-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(diethylamino)ethan-1-one |
| Molecular Weight: | 399.92 |
| Molecular Formula: | C22 H26 Cl N3 O2 |
| Salt: | not_available |
| Smiles: | CCN(CC)CC(N1C(CC(c2cccc(c2)OC)=N1)c1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5578 |
| logD: | 4.2699 |
| logSw: | -4.6479 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.835 |
| InChI Key: | HVYJNVLLMHGEIT-NRFANRHFSA-N |