N-benzyl-N-(4-fluorophenyl)-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-benzyl-N-(4-fluorophenyl)-4-methylbenzene-1-sulfonamide
N-benzyl-N-(4-fluorophenyl)-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-8454 |
| Compound Name: | N-benzyl-N-(4-fluorophenyl)-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 355.43 |
| Molecular Formula: | C20 H18 F N O2 S |
| Smiles: | Cc1ccc(cc1)S(N(Cc1ccccc1)c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9437 |
| logD: | 4.9437 |
| logSw: | -4.7044 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.792 |
| InChI Key: | PEYJIBBZRRMUPV-UHFFFAOYSA-N |