ethyl 5-benzyl-2-(4-tert-butylbenzamido)thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-benzyl-2-(4-tert-butylbenzamido)thiophene-3-carboxylate
ethyl 5-benzyl-2-(4-tert-butylbenzamido)thiophene-3-carboxylate
Compound characteristics
| Compound ID: | V012-9981 |
| Compound Name: | ethyl 5-benzyl-2-(4-tert-butylbenzamido)thiophene-3-carboxylate |
| Molecular Weight: | 421.56 |
| Molecular Formula: | C25 H27 N O3 S |
| Smiles: | CCOC(c1cc(Cc2ccccc2)sc1NC(c1ccc(cc1)C(C)(C)C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.8609 |
| logD: | 4.8206 |
| logSw: | -5.6726 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.606 |
| InChI Key: | CRXGABPQBPMHMX-UHFFFAOYSA-N |