N-[3-{[tert-butyl-N-(3-methylbutan-2-yl)carbamamido]methyl}-4-(dimethylamino)phenyl]-2-chlorobenzamide
Chemical Structure Depiction of
N-[3-{[tert-butyl-N-(3-methylbutan-2-yl)carbamamido]methyl}-4-(dimethylamino)phenyl]-2-chlorobenzamide
N-[3-{[tert-butyl-N-(3-methylbutan-2-yl)carbamamido]methyl}-4-(dimethylamino)phenyl]-2-chlorobenzamide
Compound characteristics
| Compound ID: | V013-0318 |
| Compound Name: | N-[3-{[tert-butyl-N-(3-methylbutan-2-yl)carbamamido]methyl}-4-(dimethylamino)phenyl]-2-chlorobenzamide |
| Molecular Weight: | 473.06 |
| Molecular Formula: | C26 H37 Cl N4 O2 |
| Salt: | not_available |
| Smiles: | CC(C)C(C)N(Cc1cc(ccc1N(C)C)NC(c1ccccc1[Cl])=O)C(NC(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.4014 |
| logD: | 6.3881 |
| logSw: | -5.9908 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.647 |
| InChI Key: | JBRPTZAXRKWMCV-SFHVURJKSA-N |