N-benzyl-N~2~-cyclohexyl-N~2~-(diphenylacetyl)-N-[(thiophen-2-yl)methyl]glycinamide
Chemical Structure Depiction of
N-benzyl-N~2~-cyclohexyl-N~2~-(diphenylacetyl)-N-[(thiophen-2-yl)methyl]glycinamide
N-benzyl-N~2~-cyclohexyl-N~2~-(diphenylacetyl)-N-[(thiophen-2-yl)methyl]glycinamide
Compound characteristics
| Compound ID: | V013-0580 |
| Compound Name: | N-benzyl-N~2~-cyclohexyl-N~2~-(diphenylacetyl)-N-[(thiophen-2-yl)methyl]glycinamide |
| Molecular Weight: | 536.74 |
| Molecular Formula: | C34 H36 N2 O2 S |
| Smiles: | C1CCC(CC1)N(CC(N(Cc1ccccc1)Cc1cccs1)=O)C(C(c1ccccc1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.9827 |
| logD: | 6.9827 |
| logSw: | -5.9362 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.853 |
| InChI Key: | CGSYFIGUGAHIFW-UHFFFAOYSA-N |