ethyl 1-[(4-{N-[(3-methylphenyl)methyl]propanamido}phenyl)acetyl]piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[(4-{N-[(3-methylphenyl)methyl]propanamido}phenyl)acetyl]piperidine-3-carboxylate
ethyl 1-[(4-{N-[(3-methylphenyl)methyl]propanamido}phenyl)acetyl]piperidine-3-carboxylate
Compound characteristics
| Compound ID: | V013-1174 |
| Compound Name: | ethyl 1-[(4-{N-[(3-methylphenyl)methyl]propanamido}phenyl)acetyl]piperidine-3-carboxylate |
| Molecular Weight: | 450.58 |
| Molecular Formula: | C27 H34 N2 O4 |
| Smiles: | CCC(N(Cc1cccc(C)c1)c1ccc(CC(N2CCCC(C2)C(=O)OCC)=O)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6091 |
| logD: | 4.6091 |
| logSw: | -4.3846 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.142 |
| InChI Key: | OCSLJGKMBHURDH-QHCPKHFHSA-N |