ethyl 1-[3,5-diethyl-1-(4-methoxyphenyl)-1H-pyrazole-4-carbonyl]piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[3,5-diethyl-1-(4-methoxyphenyl)-1H-pyrazole-4-carbonyl]piperidine-3-carboxylate
ethyl 1-[3,5-diethyl-1-(4-methoxyphenyl)-1H-pyrazole-4-carbonyl]piperidine-3-carboxylate
Compound characteristics
| Compound ID: | V013-1304 |
| Compound Name: | ethyl 1-[3,5-diethyl-1-(4-methoxyphenyl)-1H-pyrazole-4-carbonyl]piperidine-3-carboxylate |
| Molecular Weight: | 413.52 |
| Molecular Formula: | C23 H31 N3 O4 |
| Smiles: | CCc1c(C(N2CCCC(C2)C(=O)OCC)=O)c(CC)n(c2ccc(cc2)OC)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.556 |
| logD: | 3.556 |
| logSw: | -3.6574 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 59.735 |
| InChI Key: | VRXFTNSYEXFAHA-INIZCTEOSA-N |