N-{[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(2-fluorophenyl)methyl]-N'-(propan-2-yl)urea
Chemical Structure Depiction of
N-{[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(2-fluorophenyl)methyl]-N'-(propan-2-yl)urea
N-{[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(2-fluorophenyl)methyl]-N'-(propan-2-yl)urea
Compound characteristics
| Compound ID: | V013-1493 |
| Compound Name: | N-{[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(2-fluorophenyl)methyl]-N'-(propan-2-yl)urea |
| Molecular Weight: | 387.43 |
| Molecular Formula: | C21 H23 F2 N3 O2 |
| Smiles: | CC(C)NC(N(CC1CC(c2cccc(c2)F)=NO1)Cc1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6107 |
| logD: | 4.6107 |
| logSw: | -4.3272 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.403 |
| InChI Key: | ZEXPRXGOBRDNMI-GOSISDBHSA-N |