N-[4-(dimethylamino)-3-({N-[(oxolan-2-yl)methyl]propanamido}methyl)phenyl]-3-fluorobenzamide
Chemical Structure Depiction of
N-[4-(dimethylamino)-3-({N-[(oxolan-2-yl)methyl]propanamido}methyl)phenyl]-3-fluorobenzamide
N-[4-(dimethylamino)-3-({N-[(oxolan-2-yl)methyl]propanamido}methyl)phenyl]-3-fluorobenzamide
Compound characteristics
| Compound ID: | V013-2371 |
| Compound Name: | N-[4-(dimethylamino)-3-({N-[(oxolan-2-yl)methyl]propanamido}methyl)phenyl]-3-fluorobenzamide |
| Molecular Weight: | 427.52 |
| Molecular Formula: | C24 H30 F N3 O3 |
| Salt: | not_available |
| Smiles: | CCC(N(CC1CCCO1)Cc1cc(ccc1N(C)C)NC(c1cccc(c1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5197 |
| logD: | 3.5168 |
| logSw: | -3.8381 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.171 |
| InChI Key: | YJYHYKZUPDXHPN-OAQYLSRUSA-N |