[4-(2-butyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl][(2RS)-2-phenylcyclopropyl]methanone
Chemical Structure Depiction of
[4-(2-butyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl][(2RS)-2-phenylcyclopropyl]methanone
[4-(2-butyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl][(2RS)-2-phenylcyclopropyl]methanone
Compound characteristics
| Compound ID: | V013-2398 |
| Compound Name: | [4-(2-butyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl][(2RS)-2-phenylcyclopropyl]methanone |
| Molecular Weight: | 474.67 |
| Molecular Formula: | C28 H34 N4 O S |
| Salt: | not_available |
| Smiles: | CCCCc1nc(c2c3CCCCc3sc2n1)N1CCN(CC1)C(C1C[C@H]1c1ccccc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.8373 |
| logD: | 6.2256 |
| logSw: | -5.8908 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 40.919 |
| InChI Key: | HSIUGZGYRSUZJT-HMTLIYDFSA-N |