N-[2-(2,2-dimethylpropanamido)cyclohexyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-[2-(2,2-dimethylpropanamido)cyclohexyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide
N-[2-(2,2-dimethylpropanamido)cyclohexyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V013-4122 |
| Compound Name: | N-[2-(2,2-dimethylpropanamido)cyclohexyl]-2-[(2-fluorophenoxy)methyl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 433.54 |
| Molecular Formula: | C22 H28 F N3 O3 S |
| Smiles: | CC(C)(C)C(NC1CCCCC1NC(c1csc(COc2ccccc2F)n1)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.1718 |
| logD: | 4.1718 |
| logSw: | -4.232 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.19 |
| InChI Key: | JSIHAJDGBZHWBJ-UHFFFAOYSA-N |