N-(3-chloro-4-fluorophenyl)-2-{[4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]methyl}-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-2-{[4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]methyl}-1,3-oxazole-4-carboxamide
N-(3-chloro-4-fluorophenyl)-2-{[4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]methyl}-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V013-4260 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-2-{[4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]methyl}-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 440.9 |
| Molecular Formula: | C20 H26 Cl F N4 O4 |
| Salt: | not_available |
| Smiles: | CCOCC(CN1CCN(CC1)Cc1nc(co1)C(Nc1ccc(c(c1)[Cl])F)=O)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7414 |
| logD: | 1.4759 |
| logSw: | -2.676 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.958 |
| InChI Key: | IMAMKTCFECNNGT-HNNXBMFYSA-N |