2-{[5-(4-fluorophenyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(pyrrolidin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-{[5-(4-fluorophenyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(pyrrolidin-1-yl)ethan-1-one
2-{[5-(4-fluorophenyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(pyrrolidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | V013-4275 |
| Compound Name: | 2-{[5-(4-fluorophenyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-1-(pyrrolidin-1-yl)ethan-1-one |
| Molecular Weight: | 396.49 |
| Molecular Formula: | C21 H21 F N4 O S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)n1c(c2ccc(cc2)F)nnc1SCC(N1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2839 |
| logD: | 4.2839 |
| logSw: | -4.1446 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.471 |
| InChI Key: | WFYMYXVDVQEROZ-UHFFFAOYSA-N |