N-{[2-(dimethylamino)-5-octanamidophenyl]methyl}-3-methyl-N-(2-methylpropyl)benzamide
Chemical Structure Depiction of
N-{[2-(dimethylamino)-5-octanamidophenyl]methyl}-3-methyl-N-(2-methylpropyl)benzamide
N-{[2-(dimethylamino)-5-octanamidophenyl]methyl}-3-methyl-N-(2-methylpropyl)benzamide
Compound characteristics
| Compound ID: | V013-4319 |
| Compound Name: | N-{[2-(dimethylamino)-5-octanamidophenyl]methyl}-3-methyl-N-(2-methylpropyl)benzamide |
| Molecular Weight: | 465.68 |
| Molecular Formula: | C29 H43 N3 O2 |
| Salt: | not_available |
| Smiles: | CCCCCCCC(Nc1ccc(c(CN(CC(C)C)C(c2cccc(C)c2)=O)c1)N(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 6.8171 |
| logD: | 6.8042 |
| logSw: | -5.5288 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.103 |
| InChI Key: | BGHFGIDMNOHBDA-UHFFFAOYSA-N |