2-methoxy-N-[(4-methylphenyl)methyl]-N-{3-[2-oxo-2-(propylamino)ethyl]phenyl}acetamide
Chemical Structure Depiction of
2-methoxy-N-[(4-methylphenyl)methyl]-N-{3-[2-oxo-2-(propylamino)ethyl]phenyl}acetamide
2-methoxy-N-[(4-methylphenyl)methyl]-N-{3-[2-oxo-2-(propylamino)ethyl]phenyl}acetamide
Compound characteristics
| Compound ID: | V013-4596 |
| Compound Name: | 2-methoxy-N-[(4-methylphenyl)methyl]-N-{3-[2-oxo-2-(propylamino)ethyl]phenyl}acetamide |
| Molecular Weight: | 368.48 |
| Molecular Formula: | C22 H28 N2 O3 |
| Smiles: | CCCNC(Cc1cccc(c1)N(Cc1ccc(C)cc1)C(COC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8746 |
| logD: | 2.8746 |
| logSw: | -3.1414 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.07 |
| InChI Key: | MRMPQBFQZKVQGI-UHFFFAOYSA-N |