methyl 1-ethyl-4-[(2-methoxy-4-methylphenoxy)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 1-ethyl-4-[(2-methoxy-4-methylphenoxy)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
methyl 1-ethyl-4-[(2-methoxy-4-methylphenoxy)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | V013-5277 |
| Compound Name: | methyl 1-ethyl-4-[(2-methoxy-4-methylphenoxy)acetyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 359.42 |
| Molecular Formula: | C20 H25 N O5 |
| Smiles: | CCn1c(C)c(C(COc2ccc(C)cc2OC)=O)c(C)c1C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.3455 |
| logD: | 3.3455 |
| logSw: | -3.5563 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 50.327 |
| InChI Key: | MKIOBMINSLRMBF-UHFFFAOYSA-N |