2-methyl-N-(5-methyl-2-{3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)propanamide
Chemical Structure Depiction of
2-methyl-N-(5-methyl-2-{3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)propanamide
2-methyl-N-(5-methyl-2-{3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)propanamide
Compound characteristics
| Compound ID: | V013-5645 |
| Compound Name: | 2-methyl-N-(5-methyl-2-{3-[(3-methylphenyl)methyl]-2-oxo-1,3-diazinan-1-yl}phenyl)propanamide |
| Molecular Weight: | 379.5 |
| Molecular Formula: | C23 H29 N3 O2 |
| Smiles: | CC(C)C(Nc1cc(C)ccc1N1CCCN(Cc2cccc(C)c2)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7266 |
| logD: | 4.7264 |
| logSw: | -4.4758 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.161 |
| InChI Key: | NJEJEKRUIQVIGX-UHFFFAOYSA-N |