cyclohexyl(4-{1-(4-fluorophenyl)-3-methyl-6-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperazin-1-yl)methanone
Chemical Structure Depiction of
cyclohexyl(4-{1-(4-fluorophenyl)-3-methyl-6-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperazin-1-yl)methanone
cyclohexyl(4-{1-(4-fluorophenyl)-3-methyl-6-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | V013-6215 |
| Compound Name: | cyclohexyl(4-{1-(4-fluorophenyl)-3-methyl-6-[(4-methylphenyl)methyl]-1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperazin-1-yl)methanone |
| Molecular Weight: | 526.66 |
| Molecular Formula: | C31 H35 F N6 O |
| Salt: | not_available |
| Smiles: | Cc1ccc(Cc2nc(c3c(C)nn(c4ccc(cc4)F)c3n2)N2CCN(CC2)C(C2CCCCC2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.2351 |
| logD: | 6.1333 |
| logSw: | -5.6534 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 54.342 |
| InChI Key: | SKNLFBUMGDPCDN-UHFFFAOYSA-N |