N-[4-(dimethylamino)-3-({N-[(furan-2-yl)methyl]-2,2-dimethylpropanamido}methyl)phenyl]furan-2-carboxamide
Chemical Structure Depiction of
N-[4-(dimethylamino)-3-({N-[(furan-2-yl)methyl]-2,2-dimethylpropanamido}methyl)phenyl]furan-2-carboxamide
N-[4-(dimethylamino)-3-({N-[(furan-2-yl)methyl]-2,2-dimethylpropanamido}methyl)phenyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | V013-6379 |
| Compound Name: | N-[4-(dimethylamino)-3-({N-[(furan-2-yl)methyl]-2,2-dimethylpropanamido}methyl)phenyl]furan-2-carboxamide |
| Molecular Weight: | 423.51 |
| Molecular Formula: | C24 H29 N3 O4 |
| Salt: | not_available |
| Smiles: | CC(C)(C)C(N(Cc1cc(ccc1N(C)C)NC(c1ccco1)=O)Cc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2919 |
| logD: | 4.2896 |
| logSw: | -4.3361 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.372 |
| InChI Key: | BQNLRQKBKMJFMH-UHFFFAOYSA-N |