N~2~-[(4-chlorophenoxy)acetyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-[(4-chlorophenoxy)acetyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide
N~2~-[(4-chlorophenoxy)acetyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide
Compound characteristics
| Compound ID: | V013-7301 |
| Compound Name: | N~2~-[(4-chlorophenoxy)acetyl]-N-[(4-fluorophenyl)methyl]-N~2~-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]glycinamide |
| Molecular Weight: | 517.06 |
| Molecular Formula: | C27 H30 Cl F N2 O3 S |
| Smiles: | CC(C)CN(CC(N(Cc1ccc(cc1)F)Cc1c(C)ccs1)=O)C(COc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.4641 |
| logD: | 5.4641 |
| logSw: | -5.8942 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.123 |
| InChI Key: | HJHBZEUBEYZCDF-UHFFFAOYSA-N |