1-(4-chlorophenoxy)-3-{[(furan-2-yl)methyl](2-methylpropyl)amino}propan-2-ol
Chemical Structure Depiction of
1-(4-chlorophenoxy)-3-{[(furan-2-yl)methyl](2-methylpropyl)amino}propan-2-ol
1-(4-chlorophenoxy)-3-{[(furan-2-yl)methyl](2-methylpropyl)amino}propan-2-ol
Compound characteristics
| Compound ID: | V013-7677 |
| Compound Name: | 1-(4-chlorophenoxy)-3-{[(furan-2-yl)methyl](2-methylpropyl)amino}propan-2-ol |
| Molecular Weight: | 337.84 |
| Molecular Formula: | C18 H24 Cl N O3 |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC(COc1ccc(cc1)[Cl])O)Cc1ccco1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3726 |
| logD: | 4.1336 |
| logSw: | -4.2423 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.818 |
| InChI Key: | XQZPAHQTDVMGKT-INIZCTEOSA-N |