N-[1-(4-chlorobenzoyl)piperidin-4-yl]-N~2~-cyclopropyl-N-[(4-fluorophenyl)methyl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
Chemical Structure Depiction of
N-[1-(4-chlorobenzoyl)piperidin-4-yl]-N~2~-cyclopropyl-N-[(4-fluorophenyl)methyl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
N-[1-(4-chlorobenzoyl)piperidin-4-yl]-N~2~-cyclopropyl-N-[(4-fluorophenyl)methyl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | V013-7719 |
| Compound Name: | N-[1-(4-chlorobenzoyl)piperidin-4-yl]-N~2~-cyclopropyl-N-[(4-fluorophenyl)methyl]-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide |
| Molecular Weight: | 598.14 |
| Molecular Formula: | C31 H33 Cl F N3 O4 S |
| Smiles: | Cc1ccc(cc1)S(N(CC(N(Cc1ccc(cc1)F)C1CCN(CC1)C(c1ccc(cc1)[Cl])=O)=O)C1CC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.365 |
| logD: | 5.365 |
| logSw: | -5.9978 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 63.341 |
| InChI Key: | ARDFLHBZUOJTMX-UHFFFAOYSA-N |