2-({[(2-chlorophenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}methyl)-N-(1-phenylethyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
2-({[(2-chlorophenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}methyl)-N-(1-phenylethyl)-1,3-oxazole-4-carboxamide
2-({[(2-chlorophenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}methyl)-N-(1-phenylethyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V013-7869 |
| Compound Name: | 2-({[(2-chlorophenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}methyl)-N-(1-phenylethyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 513.04 |
| Molecular Formula: | C30 H29 Cl N4 O2 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)NC(c1coc(CN(CCc2c[nH]c3ccccc23)Cc2ccccc2[Cl])n1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5271 |
| logD: | 5.5271 |
| logSw: | -5.985 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.51 |
| InChI Key: | MZNYZJCTGMTTFJ-NRFANRHFSA-N |