N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-methyl-N'-propylurea
Chemical Structure Depiction of
N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-methyl-N'-propylurea
N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-methyl-N'-propylurea
Compound characteristics
| Compound ID: | V013-8700 |
| Compound Name: | N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-methyl-N'-propylurea |
| Molecular Weight: | 456.52 |
| Molecular Formula: | C24 H29 F N4 O4 |
| Smiles: | CCCNC(N(C)CC(N1C(CC(c2ccccc2F)=N1)c1ccc(c(c1)OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4549 |
| logD: | 3.4549 |
| logSw: | -3.8666 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.526 |
| InChI Key: | LSRQBLBHOHLPNP-HXUWFJFHSA-N |