2-chloro-N-[3-(3,4-dimethoxyphenyl)-5-methyl-1H-pyrazol-4-yl]benzamide
Chemical Structure Depiction of
2-chloro-N-[3-(3,4-dimethoxyphenyl)-5-methyl-1H-pyrazol-4-yl]benzamide
2-chloro-N-[3-(3,4-dimethoxyphenyl)-5-methyl-1H-pyrazol-4-yl]benzamide
Compound characteristics
| Compound ID: | V013-8911 |
| Compound Name: | 2-chloro-N-[3-(3,4-dimethoxyphenyl)-5-methyl-1H-pyrazol-4-yl]benzamide |
| Molecular Weight: | 371.82 |
| Molecular Formula: | C19 H18 Cl N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1c(c(c2ccc(c(c2)OC)OC)n[nH]1)NC(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.9903 |
| logD: | 2.9891 |
| logSw: | -3.7396 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.032 |
| InChI Key: | OKXNHPKFWORLKE-UHFFFAOYSA-N |