N-[3-({acetyl[(furan-2-yl)methyl]amino}methyl)-4-(dimethylamino)phenyl]-3-methylbutanamide
Chemical Structure Depiction of
N-[3-({acetyl[(furan-2-yl)methyl]amino}methyl)-4-(dimethylamino)phenyl]-3-methylbutanamide
N-[3-({acetyl[(furan-2-yl)methyl]amino}methyl)-4-(dimethylamino)phenyl]-3-methylbutanamide
Compound characteristics
| Compound ID: | V013-9389 |
| Compound Name: | N-[3-({acetyl[(furan-2-yl)methyl]amino}methyl)-4-(dimethylamino)phenyl]-3-methylbutanamide |
| Molecular Weight: | 371.48 |
| Molecular Formula: | C21 H29 N3 O3 |
| Salt: | not_available |
| Smiles: | CC(C)CC(Nc1ccc(c(CN(Cc2ccco2)C(C)=O)c1)N(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4754 |
| logD: | 3.4732 |
| logSw: | -3.8036 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.319 |
| InChI Key: | GMTOUPSOBWCPME-UHFFFAOYSA-N |