6-(morpholine-4-carbonyl)-2-phenyl-4-{[4-(trifluoromethyl)phenyl]methyl}-1,2,4-triazine-3,5(2H,4H)-dione
Chemical Structure Depiction of
6-(morpholine-4-carbonyl)-2-phenyl-4-{[4-(trifluoromethyl)phenyl]methyl}-1,2,4-triazine-3,5(2H,4H)-dione
6-(morpholine-4-carbonyl)-2-phenyl-4-{[4-(trifluoromethyl)phenyl]methyl}-1,2,4-triazine-3,5(2H,4H)-dione
Compound characteristics
| Compound ID: | V013-9419 |
| Compound Name: | 6-(morpholine-4-carbonyl)-2-phenyl-4-{[4-(trifluoromethyl)phenyl]methyl}-1,2,4-triazine-3,5(2H,4H)-dione |
| Molecular Weight: | 460.41 |
| Molecular Formula: | C22 H19 F3 N4 O4 |
| Smiles: | C1COCCN1C(C1C(N(Cc2ccc(cc2)C(F)(F)F)C(N(c2ccccc2)N=1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8296 |
| logD: | 2.8296 |
| logSw: | -3.2015 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 66.802 |
| InChI Key: | CTCLNJGYWJUGAL-UHFFFAOYSA-N |