1-(4-acetylpiperazin-1-yl)-3-{5,6-dichloro-2-[(4-methylphenyl)methyl]-1H-benzimidazol-1-yl}propan-1-one
Chemical Structure Depiction of
1-(4-acetylpiperazin-1-yl)-3-{5,6-dichloro-2-[(4-methylphenyl)methyl]-1H-benzimidazol-1-yl}propan-1-one
1-(4-acetylpiperazin-1-yl)-3-{5,6-dichloro-2-[(4-methylphenyl)methyl]-1H-benzimidazol-1-yl}propan-1-one
Compound characteristics
| Compound ID: | V014-0084 |
| Compound Name: | 1-(4-acetylpiperazin-1-yl)-3-{5,6-dichloro-2-[(4-methylphenyl)methyl]-1H-benzimidazol-1-yl}propan-1-one |
| Molecular Weight: | 473.4 |
| Molecular Formula: | C24 H26 Cl2 N4 O2 |
| Salt: | not_available |
| Smiles: | CC(N1CCN(CC1)C(CCn1c2cc(c(cc2nc1Cc1ccc(C)cc1)[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1941 |
| logD: | 4.193 |
| logSw: | -4.3734 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.438 |
| InChI Key: | USQKARAFHZBWCU-UHFFFAOYSA-N |