N-[4-(2-{[(furan-2-yl)methyl](methyl)amino}-2-oxoethyl)phenyl]-N-[(2-methylphenyl)methyl]cyclopentanecarboxamide
Chemical Structure Depiction of
N-[4-(2-{[(furan-2-yl)methyl](methyl)amino}-2-oxoethyl)phenyl]-N-[(2-methylphenyl)methyl]cyclopentanecarboxamide
N-[4-(2-{[(furan-2-yl)methyl](methyl)amino}-2-oxoethyl)phenyl]-N-[(2-methylphenyl)methyl]cyclopentanecarboxamide
Compound characteristics
| Compound ID: | V014-0223 |
| Compound Name: | N-[4-(2-{[(furan-2-yl)methyl](methyl)amino}-2-oxoethyl)phenyl]-N-[(2-methylphenyl)methyl]cyclopentanecarboxamide |
| Molecular Weight: | 444.57 |
| Molecular Formula: | C28 H32 N2 O3 |
| Smiles: | Cc1ccccc1CN(C(C1CCCC1)=O)c1ccc(CC(N(C)Cc2ccco2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.722 |
| logD: | 5.722 |
| logSw: | -5.2991 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.52 |
| InChI Key: | GPLBZTFRQYLZDH-UHFFFAOYSA-N |