1-{[(2,3-dimethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}butan-2-ol
Chemical Structure Depiction of
1-{[(2,3-dimethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}butan-2-ol
1-{[(2,3-dimethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}butan-2-ol
Compound characteristics
| Compound ID: | V014-0857 |
| Compound Name: | 1-{[(2,3-dimethoxyphenyl)methyl][(4-fluorophenyl)methyl]amino}butan-2-ol |
| Molecular Weight: | 347.43 |
| Molecular Formula: | C20 H26 F N O3 |
| Salt: | not_available |
| Smiles: | CCC(CN(Cc1ccc(cc1)F)Cc1cccc(c1OC)OC)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5658 |
| logD: | 2.7553 |
| logSw: | -3.434 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.917 |
| InChI Key: | KRHRUQBSIQXEOA-SFHVURJKSA-N |