N-({3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-phenylbutanamide
Chemical Structure Depiction of
N-({3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-phenylbutanamide
N-({3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-phenylbutanamide
Compound characteristics
| Compound ID: | V014-2137 |
| Compound Name: | N-({3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl}methyl)-2-phenylbutanamide |
| Molecular Weight: | 413.49 |
| Molecular Formula: | C26 H24 F N3 O |
| Salt: | not_available |
| Smiles: | CCC(C(NCc1cccc(c1)c1ncc(c2ccc(cc2)F)[nH]1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0404 |
| logD: | 5.0357 |
| logSw: | -4.5719 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.22 |
| InChI Key: | WSZHJHYSKOGNRT-HSZRJFAPSA-N |