1-{(cyclopropylmethyl)[(4-methoxyphenyl)methyl]amino}hex-5-en-2-ol
Chemical Structure Depiction of
1-{(cyclopropylmethyl)[(4-methoxyphenyl)methyl]amino}hex-5-en-2-ol
1-{(cyclopropylmethyl)[(4-methoxyphenyl)methyl]amino}hex-5-en-2-ol
Compound characteristics
| Compound ID: | V014-2926 |
| Compound Name: | 1-{(cyclopropylmethyl)[(4-methoxyphenyl)methyl]amino}hex-5-en-2-ol |
| Molecular Weight: | 289.42 |
| Molecular Formula: | C18 H27 N O2 |
| Salt: | not_available |
| Smiles: | COc1ccc(CN(CC2CC2)CC(CCC=C)O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5442 |
| logD: | 1.6705 |
| logSw: | -3.2859 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.6366 |
| InChI Key: | SVKPXTPBYHBQHE-KRWDZBQOSA-N |