N-{4-[2-(ethylamino)-2-oxoethyl]phenyl}-3-fluoro-N-[(4-fluorophenyl)methyl]benzamide
Chemical Structure Depiction of
N-{4-[2-(ethylamino)-2-oxoethyl]phenyl}-3-fluoro-N-[(4-fluorophenyl)methyl]benzamide
N-{4-[2-(ethylamino)-2-oxoethyl]phenyl}-3-fluoro-N-[(4-fluorophenyl)methyl]benzamide
Compound characteristics
| Compound ID: | V014-3420 |
| Compound Name: | N-{4-[2-(ethylamino)-2-oxoethyl]phenyl}-3-fluoro-N-[(4-fluorophenyl)methyl]benzamide |
| Molecular Weight: | 408.45 |
| Molecular Formula: | C24 H22 F2 N2 O2 |
| Smiles: | CCNC(Cc1ccc(cc1)N(Cc1ccc(cc1)F)C(c1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7808 |
| logD: | 3.7808 |
| logSw: | -3.9679 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.687 |
| InChI Key: | XJRUTRFVRGWINM-UHFFFAOYSA-N |