2-{3-[(2,5-difluorophenyl)methoxy]phenyl}-N-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-{3-[(2,5-difluorophenyl)methoxy]phenyl}-N-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxamide
2-{3-[(2,5-difluorophenyl)methoxy]phenyl}-N-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V014-3503 |
| Compound Name: | 2-{3-[(2,5-difluorophenyl)methoxy]phenyl}-N-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 454.47 |
| Molecular Formula: | C24 H17 F3 N2 O2 S |
| Smiles: | C(c1cccc(c1)F)NC(c1csc(c2cccc(c2)OCc2cc(ccc2F)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9723 |
| logD: | 5.9723 |
| logSw: | -6.0367 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.613 |
| InChI Key: | NOAGXJGSKJOIAE-UHFFFAOYSA-N |