1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one
Chemical Structure Depiction of
1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one
1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one
Compound characteristics
| Compound ID: | V014-4136 |
| Compound Name: | 1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one |
| Molecular Weight: | 536.55 |
| Molecular Formula: | C30 H27 F3 N2 O4 |
| Smiles: | Cc1c(CC(N2CCc3cc(c(cc3C2c2ccccc2)OC)OC)=O)nc(c2ccc(cc2)C(F)(F)F)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.724 |
| logD: | 5.724 |
| logSw: | -5.5159 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.717 |
| InChI Key: | GNKUPZLVJDRKLZ-NDEPHWFRSA-N |