1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one
					Chemical Structure Depiction of
1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one
			1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one
Compound characteristics
| Compound ID: | V014-4136 | 
| Compound Name: | 1-(6,7-dimethoxy-1-phenyl-3,4-dihydroisoquinolin-2(1H)-yl)-2-{5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl}ethan-1-one | 
| Molecular Weight: | 536.55 | 
| Molecular Formula: | C30 H27 F3 N2 O4 | 
| Smiles: | Cc1c(CC(N2CCc3cc(c(cc3C2c2ccccc2)OC)OC)=O)nc(c2ccc(cc2)C(F)(F)F)o1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 5.724 | 
| logD: | 5.724 | 
| logSw: | -5.5159 | 
| Hydrogen bond acceptors count: | 6 | 
| Polar surface area: | 48.717 | 
| InChI Key: | GNKUPZLVJDRKLZ-NDEPHWFRSA-N | 
 
				 
				