N-{4-[2-(cyclopropylamino)-2-oxoethyl]phenyl}-N-[(3-fluorophenyl)methyl]-3-methoxybenzamide
Chemical Structure Depiction of
N-{4-[2-(cyclopropylamino)-2-oxoethyl]phenyl}-N-[(3-fluorophenyl)methyl]-3-methoxybenzamide
N-{4-[2-(cyclopropylamino)-2-oxoethyl]phenyl}-N-[(3-fluorophenyl)methyl]-3-methoxybenzamide
Compound characteristics
| Compound ID: | V014-4733 |
| Compound Name: | N-{4-[2-(cyclopropylamino)-2-oxoethyl]phenyl}-N-[(3-fluorophenyl)methyl]-3-methoxybenzamide |
| Molecular Weight: | 432.49 |
| Molecular Formula: | C26 H25 F N2 O3 |
| Smiles: | COc1cccc(c1)C(N(Cc1cccc(c1)F)c1ccc(CC(NC2CC2)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1515 |
| logD: | 4.1515 |
| logSw: | -4.4671 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.389 |
| InChI Key: | PCKZHILNBCHTGM-UHFFFAOYSA-N |