4-chloro-N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide
4-chloro-N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | V014-5175 |
| Compound Name: | 4-chloro-N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 417.91 |
| Molecular Formula: | C21 H20 Cl N O4 S |
| Smiles: | COc1cccc(c1)N(Cc1ccccc1OC)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3088 |
| logD: | 5.3088 |
| logSw: | -5.9306 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.966 |
| InChI Key: | IJIOAQZHDJHRHC-UHFFFAOYSA-N |