N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-methylbenzene-1-sulfonamide
N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V014-5187 |
| Compound Name: | N-(3-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 397.49 |
| Molecular Formula: | C22 H23 N O4 S |
| Smiles: | Cc1ccc(cc1)S(N(Cc1ccccc1OC)c1cccc(c1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1375 |
| logD: | 5.1375 |
| logSw: | -5.1182 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.966 |
| InChI Key: | XXYYIKBPOICNMX-UHFFFAOYSA-N |